Salvianolic Acid A | Appearance | Solid |
| CAS | 96574-01-5 |
| Purity | 99.72% |
| Molecular Weight | 494.45 |
| Formula | C26H22O10 |
| Color | Light yellow to yellow |
| SMILES | OC1=CC=C(/C=C/C(O[C@@H](C(O)=O)CC2=CC(O)=C(O)C=C2)=O)C(/C=C/C3=CC(O)=C(O)C=C3)=C1O |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, protect from light In solvent: -80°C, 1 year; -20°C, 6 months (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-13505 | alpha-Hederin | Inquiry |
|
| PDP-19737 | Epimedin A1 (Standard) | Inquiry |
|
| PDP-19083 | Rutaevin 7-acetate | Inquiry |
|
| PDP-18903 | Yadanziolide B | Inquiry |
|
| PDP-15476 | 8-Prenyldaidzein | Inquiry |
|
| PDP-20345 | Ginsenoside F2 (Standard) | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
