Salvinorin B | Appearance | Solid |
| CAS | 92545-30-7 |
| Purity | ≥99.0% |
| Molecular Weight | 390.43 |
| Formula | C21H26O7 |
| Color | White to off-white |
| SMILES | C[C@@]12[C@@]3([C@](CC[C@]1(C(O[C@@H](C2)C4=COC=C4)=O)[H])(C)[C@H](C(OC)=O)C[C@@H](C3=O)O)[H] |
| Intended Use | For research and further manufacturing use only. |
| Storage |
-20°C, sealed storage, away from moisture In solvent: -80°C, 6 months; -20°C, 1 month (sealed storage, away from moisture) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-13386 | Momordin Ic | Inquiry |
|
| PDP-18392 | Gelsemiol | Inquiry |
|
| PDP-14816 | LC3-mHTT-IN-AN2 | Inquiry |
|
| PDP-17686 | 14-Benzoylmesaconine-8-palmitate | Inquiry |
|
| PDP-16195 | Massoia Lactone | Inquiry |
|
| PDP-16671 | Rebaudioside C | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
