Sanggenone H | Synonyms | Sanggenon H |
| CAS | 86450-80-8 |
| Molecular Weight | 354.35 |
| Formula | C20H18O6 |
| SMILES | OC1=C2C(OC(C)(C=C2)C)=C([C@@]3([H])OC4=CC(O)=CC(O)=C4C(C3)=O)C=C1 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-20245 | Petasites Japonicus Extract | Inquiry |
|
| PDP-19687 | trans-Cinnamaldehyde (Standard) | Inquiry |
|
| PDP-13868 | beta-Mangostin | Inquiry |
|
| PDP-15344 | Epigomisin O | Inquiry |
|
| PDP-15152 | 7-Hydroxy-4H-chromen-4-one | Inquiry |
|
| PDP-19502 | Hydroquinidine (Standard) | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.