Sannamycin B | CAS No. | 72503-80-1 |
| Molecular Weight | 332.44 |
| Formula | C15H32N4O4 |
| SMILES | O[C@H]1[C@H](O[C@@H]2[C@H](N)CC[C@@H](CNC)O2)[C@@H](N)C[C@H](OC)[C@H]1NC |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-24083 | Pristinamycin ⅠC | Inquiry |
|
| MDP-22552 | 7-Demethylnaphterpin | Inquiry |
|
| MDP-22253 | Mnm5s2U | Inquiry |
|
| MDP-11355 | Gibberellic Acid | Inquiry |
|
| MDP-12480 | Fumitremorgin B | Inquiry |
|
| MDP-12029 | Ganosporeric Acid A | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
