Sannamycin J | CAS No. | 83997-42-6 |
| Molecular Weight | 318.41 |
| Formula | C14H30N4O4 |
| SMILES | NC[C@H]1O[C@@H]([C@@H](CC1)N)O[C@H]2[C@@H]([C@@H]([C@@H](C[C@@H]2N)OC)NC)O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-23207 | Phepropeptin C | Inquiry |
|
| MDP-24171 | Cycloheptamycin | Inquiry |
|
| MDP-23319 | Sorbic Acid (Standard) | Inquiry |
|
| MDP-22215 | Agistatin B | Inquiry |
|
| MDP-12683 | Anserinone B | Inquiry |
|
| MDP-12751 | Quellenin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
