Santin | Appearance | Solid |
| CAS | 27782-63-4 |
| Purity | 99.39% |
| Molecular Weight | 344.32 |
| Formula | C18H16O7 |
| Color | Light yellow to yellow |
| SMILES | O=C1C(OC)=C(C2=CC=C(OC)C=C2)OC3=CC(O)=C(C(O)=C13)OC |
| Intended Use | For research and further manufacturing use only. |
| Storage |
-20°C, protect from light, stored under nitrogen In solvent: -80°C, 6 months; -20°C, 1 month (protect from light, stored under nitrogen) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-15241 | Epoxyazadiradione | Inquiry |
|
| PDP-18337 | Ducheside A | Inquiry |
|
| PDP-17046 | Kansuinine B | Inquiry |
|
| PDP-16532 | (-)-Zuonin A | Inquiry |
|
| PDP-17973 | 3-Furfuryl 2-pyrrolecarboxylate | Inquiry |
|
| PDP-18054 | 9-Oxonerolidol | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
