Sarubicin B | CAS No. | 84745-01-7 |
| Molecular Weight | 258.23 |
| Formula | C13H10N2O4 |
| SMILES | O=C(N)C(C1=O)=C(C(C2=C1C=CC=C2C(C)=O)=O)N |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-12244 | Niacin (standard) | Inquiry |
|
| MDP-22500 | 3-Hydroxyphenylacetic Acid (Standard) | Inquiry |
|
| MDP-11946 | Stictic Acid | Inquiry |
|
| MDP-12479 | Aspochalasin M | Inquiry |
|
| MDP-11132 | Glycodeoxycholic Acid | Inquiry |
|
| MDP-23859 | Pelagiomicin B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
