Saudin | CAS | 94978-16-2 |
| Molecular Weight | 374.38 |
| Formula | C20H22O7 |
| SMILES | O=C1OC[C@]23[C@@]1(C)CC[C@]4(O5)[C@@]2(C)[C@@](C[C@](O4)(C6=COC=C6)O3)([H])[C@H](C)C5=O |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-15889 | Lucidin Primeveroside | Inquiry |
|
| PDP-19216 | Seselin | Inquiry |
|
| PDP-19599 | Neolancerin | Inquiry |
|
| PDP-18695 | Jolkinolide E | Inquiry |
|
| PDP-16024 | Ajugacumbin B | Inquiry |
|
| PDP-14670 | Kalii Dehydrographolidi Succinas | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
