Savinin | Synonyms | (-)-Savinin |
| CAS | 493-95-8 |
| Molecular Weight | 352.34 |
| Formula | C20H16O6 |
| SMILES | O=C1OC[C@H](CC2=CC=C(OCO3)C3=C2)/C1=C\C4=CC=C(OCO5)C5=C4 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-15915 | Isoegomaketone | Inquiry |
|
| PDP-16002 | Anemarsaponin E | Inquiry |
|
| PDP-20257 | (Rac)-Ganoderic Acid C2 | Inquiry |
|
| PDP-18728 | Bryonamide B | Inquiry |
|
| PDP-17541 | Apigravin | Inquiry |
|
| PDP-18965 | Antiproliferative Agent-28 | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
