Schisanlignone B | CAS | 135459-86-8 |
| Molecular Weight | 416.46 |
| Formula | C23H28O7 |
| SMILES | O=C1C2=CC(O)=C(C(OC)=C2C3=C(C[C@H]([C@H]1C)C)C=C(OC)C(OC)=C3OC)OC |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-17624 | Leocarpinolide F | Inquiry |
|
| PDP-17640 | Thevebioside | Inquiry |
|
| PDP-16292 | Gluten Exorphin B5 | Inquiry |
|
| PDP-14679 | Oxyresveratrol 2-O-β-D-glucopyranoside | Inquiry |
|
| PDP-14385 | 5,7,3',4'-Tetramethoxyflavone | Inquiry |
|
| PDP-16701 | Isoscabertopin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.