Schizozygine | CAS | 2047-63-4 |
| Molecular Weight | 336.38 |
| Formula | C20H20N2O3 |
| SMILES | O=C1N2[C@]34[C@]5([H])[C@@](C1)(C=CCN5CC[C@@]4([H])C6=CC(OCO7)=C7C=C62)CC3 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-16970 | Chamazulene | Inquiry |
|
| PDP-14411 | Angoroside C | Inquiry |
|
| PDP-14022 | Ginkgolic Acid (C13:0) | Inquiry |
|
| PDP-14913 | (Rac)-Arnebin 1 | Inquiry |
|
| PDP-18203 | Lupanine Hydrochloride | Inquiry |
|
| PDP-19394 | Tenacigenin B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
