Scopoletin | Synonyms | Gelseminic Acid; Chrysatropic Acid |
| Appearance | Solid |
| CAS | 92-61-5 |
| Purity | 99.89% |
| Molecular Weight | 192.17 |
| Formula | C10H8O4 |
| Color | White to yellow |
| SMILES | O=C1C=CC2=CC(OC)=C(O)C=C2O1 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
Powder: -20°C 3 years; 4°C 2 years In solvent: -80°C 6 months; -20°C 1 month |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-16650 | Arabinoxylan (Medium Viscosity) | Inquiry |
|
| PDP-19315 | Camellianin A | Inquiry |
|
| PDP-20568 | Ginkgetin (Standard) | Inquiry |
|
| PDP-17490 | Xerophilusin B | Inquiry |
|
| PDP-16963 | Eupatarone | Inquiry |
|
| PDP-16699 | 2,3-Dehydrokievitone | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
