(+)-Secolongifolene-diol | CAS No. | 53587-37-4 |
| Molecular Weight | 238.37 |
| Formula | C15H26O2 |
| SMILES | OCC[C@@H]1[C@@]2(C)CCCC(C)(C)[C@]1([H])C=C2CO |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-24262 | Glidobactin B | Inquiry |
|
| MDP-11862 | Glycyl-L-leucine | Inquiry |
|
| MDP-12421 | α-Factor Mating Pheromone, Yeast (Standard) | Inquiry |
|
| MDP-23491 | Arisugacin E | Inquiry |
|
| MDP-22574 | 6'''-Deamino-6'''-hydroxyneomycin B | Inquiry |
|
| MDP-23953 | Parvodicin B2 | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
