Seneciphyllinine | CAS | 90341-45-0 |
| Molecular Weight | 375.42 |
| Formula | C20H25NO6 |
| SMILES | O=C(O[C@]1([H])CCN2[C@]1([H])C(COC([C@](C)(OC(C)=O)C(C/3)=C)=O)=CC2)C3=C/C |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-15152 | 7-Hydroxy-4H-chromen-4-one | Inquiry |
|
| PDP-17485 | Monnierisides A | Inquiry |
|
| PDP-14884 | Mogroside VI B | Inquiry |
|
| PDP-16629 | 2,6,10,14-Tetramethylhexadecane | Inquiry |
|
| PDP-18875 | Neocyclomorusin | Inquiry |
|
| PDP-14774 | Segetalin B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
