Sesamin | Appearance | Solid |
| CAS | 607-80-7 |
| Purity | 99.70% |
| Molecular Weight | 354.35 |
| Formula | C20H18O6 |
| Color | White to off-white |
| SMILES | [H][C@@]12[C@@H](C3=CC=C(OCO4)C4=C3)OC[C@]1([H])[C@@H](C5=CC=C(OCO6)C6=C5)OC2 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
Powder: -20°C 3 years In solvent: -80°C 6 months; -20°C 1 month |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-18377 | Ferulamide | Inquiry |
|
| PDP-16552 | 4,2',4',6'-Tetramethoxychalcone | Inquiry |
|
| PDP-14305 | Fustin | Inquiry |
|
| PDP-18524 | Clematichinenoside C | Inquiry |
|
| PDP-18778 | Ebracteolata Cpd B | Inquiry |
|
| PDP-13970 | 7-Ethoxycoumarin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.