Sibiricose A1 | Appearance | Solid |
| CAS | 139726-40-2 |
| Purity | 99.46% |
| Molecular Weight | 548.49 |
| Formula | C23H32O15 |
| Color | Off-white to light yellow |
| SMILES | OC[C@]1(O[C@@H]([C@H]([C@@H]1O)O)CO)O[C@H]2O[C@@H]([C@H]([C@@H]([C@H]2O)O)O)COC(/C=C/C3=CC(OC)=C(C(OC)=C3)O)=O |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-17151 | Bulnesol | Inquiry |
|
| PDP-13178 | Hesperidin | Inquiry |
|
| PDP-17372 | Quercetin-3-O-b-D-galactopyranosyl-(1→6)-b-D-glucopyranoside | Inquiry |
|
| PDP-14835 | Huperzine B | Inquiry |
|
| PDP-15302 | 7-Prenyloxycoumarin | Inquiry |
|
| PDP-18371 | Euxanthone | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
