Siraitic Acid B | CAS | 183374-16-5 |
| Molecular Weight | 470.64 |
| Formula | C29H42O5 |
| SMILES | O=C1[C@]23[C@@]4([H])[C@](CC[C@@]3([H])[C@@]5(C)[C@@](C)([C@@](CC5)([H])[C@H](C)CC/C=C(C)/C(O)=O)C1)([C@H](C(CC4)=O)C)OC2 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-19171 | 6,4'-Dihydroxy-7-methoxyflavanone | Inquiry |
|
| PDP-14884 | Mogroside VI B | Inquiry |
|
| PDP-16444 | (E)-Cinnamamide | Inquiry |
|
| PDP-14836 | Isorhamnetin 3-O-galactoside | Inquiry |
|
| PDP-15382 | 3-Hydroxycoumarin | Inquiry |
|
| PDP-13772 | Ethyl Gallate | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
