Sootepin D | CAS | 1154518-97-4 |
| Molecular Weight | 484.71 |
| Formula | C31H48O4 |
| SMILES | COC(CC[C@@]12[C@]3([C@](CC[C@H]2C(CO)=C)([H])[C@]4([C@@](C)([C@]([C@H](C)CC/C=C(C)/C=O)([H])CC4)CC3)C)C1)=O |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-15016 | Bruceine B | Inquiry |
|
| PDP-20111 | cis-p-Coumaric Acid | Inquiry |
|
| PDP-17525 | Inuviscolide | Inquiry |
|
| PDP-17812 | Sarglaroids F | Inquiry |
|
| PDP-17049 | Sericic Acid | Inquiry |
|
| PDP-14294 | Osthenol | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
