Sophoraflavanone G | Synonyms | Kushenol F |
| Appearance | Solid |
| CAS | 97938-30-2 |
| Purity | 99.52% |
| Molecular Weight | 424.49 |
| Formula | C25H28O6 |
| Color | Off-white to light yellow |
| SMILES | O=C1C[C@@H](C2=CC=C(O)C=C2O)OC3=C(C[C@H](C(C)=C)C/C=C(C)\C)C(O)=CC(O)=C13 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
Powder: -20°C 3 years In solvent: -80°C 6 months; -20°C 1 month |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-16713 | Arjunic Acid | Inquiry |
|
| PDP-15617 | 9'''-Methyl Salvianolate B | Inquiry |
|
| PDP-18039 | 6β-Hydroxyipolamiide | Inquiry |
|
| PDP-16256 | 3,5,7-Trihydroxychromone | Inquiry |
|
| PDP-15398 | Pongamol | Inquiry |
|
| PDP-18899 | Neotripterifordin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
