Sophoraflavanone I | CAS | 136997-69-8 |
| Molecular Weight | 650.71 |
| Formula | C39H38O9 |
| SMILES | OC1=CC(O)=CC([C@]([C@@](C(C=C2)=CC=C2O)([H])OC3=C4)([H])C3=CC([C@@](CC5=O)([H])OC(C5=C6O)=C(C(O)=C6)C[C@H](C(C)=C)C/C=C(C)\C)=C4O)=C1 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-20112 | Bacoside A3 (Standard) | Inquiry |
|
| PDP-18588 | Ludaconitine | Inquiry |
|
| PDP-12949 | Turmeric Root Extract | Inquiry |
|
| PDP-13727 | S-1-Propenyl-L-cysteine | Inquiry |
|
| PDP-16166 | Podecdysone B | Inquiry |
|
| PDP-16244 | Shizukaol B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
