Soyasapogenol B | Appearance | Solid |
| CAS | 595-15-3 |
| Purity | 99.91% |
| Molecular Weight | 458.72 |
| Formula | C30H50O3 |
| Color | White to off-white |
| SMILES | C[C@]12[C@]3(C([C@@]4([H])[C@](C)([C@@H](CC(C)(C)C4)O)CC3)=CC[C@]1([H])[C@@]5([C@@]([C@](C)([C@@H](O)CC5)CO)([H])CC2)C)C |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-16977 | Neoamygdalin | Inquiry |
|
| PDP-17971 | 3-epi-Cabraleahydroxylactone | Inquiry |
|
| PDP-19785 | Notopterol (Standard) | Inquiry |
|
| PDP-18488 | Protodeltonin | Inquiry |
|
| PDP-19084 | Schisandrin C Epoxide | Inquiry |
|
| PDP-15643 | Suavissimoside R1 | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
