Sporeamicin A | CAS No. | 131418-65-0 |
| Molecular Weight | 713.90 |
| Formula | C37H63NO12 |
| SMILES | C[C@]12[C@H](OC([C@@H]([C@H]([C@@H]([C@H]([C@](O)(C[C@H](C(O1)=C(C2=O)C)C)C)O[C@H]3[C@@H]([C@H](C[C@H](O3)C)N(C)C)O)C)O[C@H]4C[C@](C)([C@H]([C@@H](O4)C)O)OC)C)=O)CC |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-22104 | Nanangenine B | Inquiry |
|
| MDP-12001 | Cyclo(L-Phe-trans-4-OH-L-Pro) | Inquiry |
|
| MDP-22724 | 3-Methoxybenzoic Acid (Standard) | Inquiry |
|
| MDP-22557 | N-Formylfortimicin A | Inquiry |
|
| MDP-12201 | Microcolin H | Inquiry |
|
| MDP-23533 | Hericenone B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.