Stachybotramide | CAS No. | 149598-71-0 |
| Molecular Weight | 429.55 |
| Formula | C25H35NO5 |
| SMILES | C[C@@]([C@@](C(C)1C)([H])CC2)(CC[C@H]1O)[C@@]3([C@@H]2C)OC4=C(CN5CCO)C(C5=O)=CC(O)=C4C3 |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-22719 | 2-Methylquinazolin-4-ol (Standard) | Inquiry |
|
| MDP-22118 | Theobromine (Standard) | Inquiry |
|
| MDP-23324 | Kocurin | Inquiry |
|
| MDP-23747 | Glysperin B | Inquiry |
|
| MDP-11841 | 10-Undecenoic Acid Zinc Salt | Inquiry |
|
| MDP-12017 | Hygromycin B (Standard) | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
