Stachybotrylactam | CAS No. | 163391-76-2 |
| Molecular Weight | 385.50 |
| Formula | C23H31NO4 |
| SMILES | O=C1NCC2=C1C=C(C3=C2O[C@@]4(C3)[C@](C)([C@]5(CC[C@H]4C)[H])CC[C@H](C5(C)C)O)O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-10926 | Quercetin | Inquiry |
|
| MDP-23482 | Astechrome | Inquiry |
|
| MDP-11738 | Solanidine | Inquiry |
|
| MDP-23682 | 2-Hydroxymethylclavam | Inquiry |
|
| MDP-24011 | Rhodomycin B | Inquiry |
|
| MDP-24279 | 6-O-Demethyl-5-deoxyfusarubin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
