Stevioside E | CAS | 1309929-72-3 |
| Molecular Weight | 951.01 |
| Formula | C44H70O22 |
| SMILES | C[C@]12[C@@]3([H])[C@@]4(CC[C@]1([H])[C@@](C)(CCC2)C(O[C@@H]5O[C@@H]([C@H]([C@@H]([C@H]5O)O)O)CO)=O)C[C@](C(C4)=C)(CC3)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O[C@@H]7O[C@@H]([C@H]([C@@H]([C@H]7O)O)O)CO)O[C@H]8[C@@H]([C@H]([C@@H]([C@H](O8)C)O)O)O |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-20354 | Paradol (Standard) | Inquiry |
|
| PDP-14142 | Azadirachtin B | Inquiry |
|
| PDP-20110 | Cajaninstilbene Acid | Inquiry |
|
| PDP-17417 | 4(1H)-Quinolinone, 1-methyl-2-(5Z)-5-undecen-1-yl- | Inquiry |
|
| PDP-14050 | Santonin | Inquiry |
|
| PDP-14486 | (E)-Flavokawain A | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
