Stigmasterol Glucoside | Appearance | Solid |
| CAS | 19716-26-8 |
| Purity | 99.38% |
| Molecular Weight | 574.83 |
| Formula | C35H58O6 |
| Color | White to off-white |
| SMILES | OC[C@H]([C@@H](O)[C@H](O)[C@H]1O)O[C@@]1([H])O[C@H](C2)CC[C@@]3(C)C2=CC[C@]4([H])[C@]3([H])CC[C@@]5(C)[C@]4(CC[C@]5([H])[C@H](C)/C=C/[C@@H](CC)C(C)C)[H] |
| Intended Use | For research and further manufacturing use only. |
| Storage |
-20°C, sealed storage, away from moisture and light In solvent: -80°C, 6 months; -20°C, 1 month (sealed storage, away from moisture and light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-20418 | Psoralen (Standard) | Inquiry |
|
| PDP-13446 | Sodium Salicylate | Inquiry |
|
| PDP-14042 | Calceolarioside B | Inquiry |
|
| PDP-19651 | Obacunone (Standard) | Inquiry |
|
| PDP-14364 | Alisol A 24-acetate | Inquiry |
|
| PDP-16072 | Acanthoside B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
