Stilbostemin B | CAS | 162411-67-8 |
| Molecular Weight | 228.29 |
| Formula | C15H16O2 |
| SMILES | OC1=CC(CCC2=CC=CC=C2)=CC(O)=C1C |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-14063 | Hydrastine | Inquiry |
|
| PDP-13696 | Cimifugin | Inquiry |
|
| PDP-13631 | 8-Gingerol | Inquiry |
|
| PDP-13386 | Momordin Ic | Inquiry |
|
| PDP-18058 | Agrimonolide 6-O-β-D-glucoside | Inquiry |
|
| PDP-13664 | Gypenoside L | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.