Subelliptenone G | Synonyms | 1,4,5-Trihydroxyxanthone |
| CAS | 162473-22-5 |
| Molecular Weight | 244.20 |
| Formula | C13H8O5 |
| SMILES | O=C1C2=C(OC3=C1C=CC=C3O)C(O)=CC=C2O |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-13251 | Piperine | Inquiry |
|
| PDP-16972 | Mesembrine | Inquiry |
|
| PDP-14996 | Deoxyandrographolide | Inquiry |
|
| PDP-12988 | Luteolin Extract | Inquiry |
|
| PDP-16120 | Saikosaponin G | Inquiry |
|
| PDP-16187 | 11-Methoxyyangonin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
