Tacrolimus Monohydrate | CAS No. | 109581-93-3 |
| Purity | 99.67% |
| Synonyms | FK506 Monohydrate; Fujimycin Monohydrate; FR900506 Monohydrate |
| Molecular Weight | 822.03 |
| Formula | C44H71NO13 |
| Appearance | Solid |
| Color | White to off-white |
| SMILES | O=C([C@@](CCCC1)([H])N1C(C([C@@]2(O)[C@H](C)C[C@H](OC)[C@@](O2)([H])[C@@H](OC)C[C@@H](C)C/C(C)=C/[C@H]3CC=C)=O)=O)O[C@H](/C(C)=C/[C@H]4C[C@@H](OC)[C@H](O)CC4)[C@H](C)[C@@H](O)CC3=O.O |
| Intended Use | For research use only. |
| Shipping | Room temperature |
| Storage |
4°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-23965 | Concanamycin F | Inquiry |
|
| MDP-12577 | Beauverolide Ka | Inquiry |
|
| MDP-24256 | Cedarmycin B | Inquiry |
|
| MDP-22944 | γ-Rubromycin | Inquiry |
|
| MDP-23228 | cis-3-Hexen-1-ol (Standard) | Inquiry |
|
| MDP-23679 | Orotidine 5'-monophosphate | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
