Tanshinol B | CAS | 189290-30-0 |
| Molecular Weight | 296.32 |
| Formula | C18H16O4 |
| SMILES | O=C1C2=C(CCCC3(O)C)C3=CC=C2C4=C(C(C)=CO4)C1=O |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-14705 | Beta-Acetoxyisovalerylshikonin | Inquiry |
|
| PDP-15955 | 4'-Dihydrophaseic Acid | Inquiry |
|
| PDP-13553 | (S)-Indoximod | Inquiry |
|
| PDP-15860 | Anisylacetone | Inquiry |
|
| PDP-20137 | Beta-Sitosterol (purity>98%) (Standard) | Inquiry |
|
| PDP-17455 | Jacquilenin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
