Taxifolin 7-O-rhamnoside | Synonyms | Taxifolin 7-O-α-L-rhamnoside |
| Appearance | Solid |
| CAS | 137592-12-2 |
| Purity | 99.61% |
| Molecular Weight | 450.39 |
| Formula | C21H22O11 |
| Color | Off-white to light yellow |
| SMILES | O=C1C2=C(O)C=C(O[C@H]3[C@@H]([C@@H]([C@@H](O)[C@H](C)O3)O)O)C=C2O[C@H](C4=CC(O)=C(O)C=C4)[C@H]1O |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-14755 | 5-O-Demethylnobiletin | Inquiry |
|
| PDP-14785 | Aloesin | Inquiry |
|
| PDP-19508 | Sibiriquinone A | Inquiry |
|
| PDP-18009 | (±)-trans-Abscisic Acid | Inquiry |
|
| PDP-20153 | Toddalolactone (Standard) | Inquiry |
|
| PDP-15384 | Arjunetin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
