Tenulin | CAS | 19202-92-7 |
| Molecular Weight | 306.35 |
| Formula | C17H22O5 |
| SMILES | C[C@]12[C@@]3([H])[C@](OC2(O)C)([H])[C@]4([C@](C=CC4=O)([H])[C@@H](C[C@]3([H])OC1=O)C)C |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-14697 | Nasunin | Inquiry |
|
| PDP-19324 | Dipsanoside B | Inquiry |
|
| PDP-14754 | Synephrine Hydrochloride | Inquiry |
|
| PDP-13664 | Gypenoside L | Inquiry |
|
| PDP-17724 | 6,7,8-Trihydroxy-2-(2-Phenethyl) Chromone | Inquiry |
|
| PDP-20201 | Actein (Standard) | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
