Tetrahydroberberine | Synonyms | Canadine |
| Appearance | Solid |
| CAS | 522-97-4 |
| Purity | 98.61% |
| Molecular Weight | 339.39 |
| Formula | C20H21NO4 |
| Color | Light yellow to yellow |
| SMILES | COC1=CC=C(CC23)C(CN2CCC(C3=C4)=CC5=C4OCO5)=C1OC |
| Intended Use | For research and further manufacturing use only. |
| Storage |
Powder: -20°C 3 years; 4°C 2 years In solvent: -80°C 2 years; -20°C 1 year |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-18189 | Magnolignan C | Inquiry |
|
| PDP-17484 | Spiranthol A | Inquiry |
|
| PDP-15150 | Genipin 1-β-D-gentiobioside | Inquiry |
|
| PDP-20575 | Fangchinoline (Standard) | Inquiry |
|
| PDP-17618 | Cnidioside B | Inquiry |
|
| PDP-16311 | (20R)-Ginsenoside Rh1 | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
