Tetrandrine | Synonyms | NSC-77037; D-Tetrandrine |
| Appearance | Solid |
| CAS | 518-34-3 |
| Purity | 99.91% |
| Molecular Weight | 622.75 |
| Formula | C38H42N2O6 |
| Color | White to off-white |
| SMILES | COC1=CC(CCN(C)[C@@]2([H])CC3=CC(O4)=C(OC)C=C3)=C2C(OC5=C(OC)C=C6C([C@]([H])(CC7=CC=C4C=C7)N(C)CC6)=C5)=C1OC |
| Intended Use | For research and further manufacturing use only. |
| Storage |
Powder: -20°C 3 years; 4°C 2 years In solvent: -80°C 2 years; -20°C 1 year |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-18278 | Cimiside B | Inquiry |
|
| PDP-16942 | Rankinidine | Inquiry |
|
| PDP-17072 | Guajadial F | Inquiry |
|
| PDP-17274 | Pedaliin 6"-acetate | Inquiry |
|
| PDP-20201 | Actein (Standard) | Inquiry |
|
| PDP-18844 | Lagotisoide D | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
