Thapsigargicin | Synonyms | Thapsigargicine |
| CAS | 67526-94-7 |
| Molecular Weight | 622.70 |
| Formula | C32H46O12 |
| SMILES | CC1=C2[C@]([C@](C)(C[C@@H]([C@]3([C@@]2([H])OC([C@]3(O)C)=O)O)OC(CCC)=O)OC(C)=O)([H])[C@@H]([C@H]1OC(/C(C)=C\C)=O)OC(CCCCC)=O |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-17152 | 7-Methoxy-4-methyl-coumarin-8-ol | Inquiry |
|
| PDP-20137 | Beta-Sitosterol (purity>98%) (Standard) | Inquiry |
|
| PDP-13922 | Amarogentin | Inquiry |
|
| PDP-15262 | Ganoderic Acid G | Inquiry |
|
| PDP-13634 | Safranal | Inquiry |
|
| PDP-19960 | Proanthocyanidin A4 (Standard) | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
