Tigloidin | Synonyms | Tigloyl Pseudotropine; Tiglylpseudotropine; Tiglyssin |
| Appearance | Liquid (Density: 1.06±0.1 g/cm3) |
| CAS | 495-83-0 |
| Purity | 99.91% |
| Molecular Weight | 223.31 |
| Formula | C13H21NO2 |
| Color | Light yellow to yellow |
| SMILES | C/C=C(C)/C(O[C@H]1C[C@@H](N2C)CC[C@@H]2C1)=O |
| Intended Use | For research and further manufacturing use only. |
| Storage |
Pure form -20°C 3 years; 4°C 2 years In solvent: -80°C 6 months; -20°C 1 month |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-14539 | Gelsemine | Inquiry |
|
| PDP-17217 | Morusignin L | Inquiry |
|
| PDP-20030 | 7,3'-Dihydroxy Flavonone-4'-O-β-D-glucopyranoside | Inquiry |
|
| PDP-13819 | Eupalinolide B | Inquiry |
|
| PDP-14850 | Nordalbergin | Inquiry |
|
| PDP-16531 | Quinine Sulfate Hydrate | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
