Tilianin | Appearance | Solid |
| CAS | 4291-60-5 |
| Purity | 99.67% |
| Molecular Weight | 446.40 |
| Formula | C22H22O10 |
| Color | Off-white to light yellow |
| SMILES | O=C1C2=C(O)C=C(O[C@@H]3O[C@@H]([C@@H](O)[C@H](O)[C@H]3O)CO)C=C2OC(C4=CC=C(OC)C=C4)=C1 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-18870 | Haginin A | Inquiry |
|
| PDP-19529 | Methylzedoarondiol | Inquiry |
|
| PDP-14786 | Demethylsuberosin | Inquiry |
|
| PDP-14621 | Licoflavone A | Inquiry |
|
| PDP-18855 | Hemiphloin | Inquiry |
|
| PDP-17826 | Smyrindioloside | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
