(±)-Trolline | Synonyms | (±)-Oleracein E |
| CAS | 1021950-79-7 |
| Molecular Weight | 219.24 |
| Formula | C12H13NO3 |
| SMILES | O=C1N2CCC3=CC(O)=C(C=C3C2CC1)O |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-14427 | 1beta-Hydroxyalantolactone | Inquiry |
|
| PDP-17203 | TF-3-G-cThea | Inquiry |
|
| PDP-15675 | Kaempferol 7-O-neohesperidoside | Inquiry |
|
| PDP-19075 | Germanicol Acetate | Inquiry |
|
| PDP-18917 | Drimenol | Inquiry |
|
| PDP-14162 | Xanthotoxol | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
