Tsugaric Acid A (Standard) | CAS No. | 174391-64-1 |
| Molecular Weight | 498.74 |
| Formula | C32H50O4 |
| SMILES | C[C@]12C3=C(CC[C@@]1([C@]([C@H](C(O)=O)CC/C=C(C)/C)([H])CC2)C)[C@@]4([C@@](C(C)([C@H](OC(C)=O)CC4)C)([H])CC3)C |
| Intended Use | For research use only. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-11825 | Ochratoxin B | Inquiry |
|
| MDP-22569 | N-Acetyl-L-methionine (Standard) | Inquiry |
|
| MDP-21966 | Ganodermanondiol | Inquiry |
|
| MDP-11375 | Pyrroloquinoline Quinone Disodium Salt | Inquiry |
|
| MDP-23441 | Isariin B | Inquiry |
|
| MDP-23361 | Methyl 3-methoxyacrylate (Standard) | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
