Tylosin Tartrate | CAS No. | 74610-55-2 |
| Purity | ≥98.0% |
| Molecular Weight | 1066.19 |
| Formula | C50H83NO23 |
| Appearance | Solid |
| Color | White to off-white |
| SMILES | C[C@@H](O[C@@]1([H])O[C@H]([C@H]([C@@H](CC2=O)O)C)[C@H](C[C@H](C(/C=C/C(C)=C/[C@H](CO[C@H](O[C@H](C)[C@@H](O)[C@H]3OC)[C@@H]3OC)[C@@H](CC)O2)=O)C)CC=O)[C@H]([C@@H]([C@H]1O)N(C)C)O[C@@](O[C@@H](C)[C@@H]4O)([H])C[C@]4(O)C.O[C@@H](C(O)=O)[C@@H](O)C(O)=O |
| Intended Use | For research use only. |
| Shipping | Room temperature |
| Storage |
4°C, sealed storage, away from moisture In solvent: -80°C, 6 months; -20°C, 1 month (sealed storage, away from moisture) |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-23709 | Concanamycin G | Inquiry |
|
| MDP-12664 | Asperglaucin B | Inquiry |
|
| MDP-10966 | L-Glutamic Acid | Inquiry |
|
| MDP-22215 | Agistatin B | Inquiry |
|
| MDP-12071 | 2'-Aminoacetophenone | Inquiry |
|
| MDP-11699 | 2,3-Butanediol | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
