Ulopterol | Synonyms | Peucedanol Methyl Ether |
| CAS | 28095-18-3 |
| Molecular Weight | 278.30 |
| Formula | C15H18O5 |
| SMILES | O=C1C=CC2=CC(C[C@@H](O)C(C)(O)C)=C(OC)C=C2O1 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-18331 | Dimeric Coniferyl Acetate | Inquiry |
|
| PDP-16689 | Ophiopogonone C | Inquiry |
|
| PDP-14152 | Licarin B | Inquiry |
|
| PDP-18451 | Dehydroeburicoic Acid Monoacetate | Inquiry |
|
| PDP-19866 | Dihydroberberine (Standard) | Inquiry |
|
| PDP-18521 | Gentiournoside D | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
