Vanicoside B | Appearance | Solid |
| CAS | 155179-21-8 |
| Purity | 99.82% |
| Molecular Weight | 956.89 |
| Formula | C49H48O20 |
| Color | White to off-white |
| SMILES | OC(C=C1)=CC=C1/C=C/C(OC[C@@]2([C@H]([C@@H]([C@H](O2)COC(/C=C/C3=CC=C(C=C3)O)=O)O)OC(/C=C/C4=CC=C(C=C4)O)=O)O[C@H]5O[C@@H]([C@H]([C@@H]([C@H]5O)O)O)COC(/C=C/C6=CC(OC)=C(C=C6)O)=O)=O |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-19692 | Protoescigenin 21-tiglate | Inquiry |
|
| PDP-15864 | Theasaponin E2 | Inquiry |
|
| PDP-16386 | Tenacissoside A | Inquiry |
|
| PDP-13000 | Tongkat Ali Extract | Inquiry |
|
| PDP-14624 | DL-Methionine | Inquiry |
|
| PDP-19394 | Tenacigenin B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
