(-)-Variabilin | CAS | 370102-93-5 |
| Molecular Weight | 300.31 |
| Formula | C17H16O5 |
| SMILES | O[C@@]12COC3=CC(OC)=CC=C3[C@]1([H])OC4=CC(OC)=CC=C42 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-14162 | Xanthotoxol | Inquiry |
|
| PDP-15471 | Thaumatin B | Inquiry |
|
| PDP-20073 | α-Glucosidase-IN-70 | Inquiry |
|
| PDP-19584 | Coronalolic Acid | Inquiry |
|
| PDP-15780 | Pinocembrin Chalcone | Inquiry |
|
| PDP-19066 | Uncarine A | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
