Variculanol | CAS No. | 135513-21-2 |
| Molecular Weight | 372.58 |
| Formula | C25H40O2 |
| SMILES | O[C@@H]1C[C@](C)([C@@H](/C=C(CC[C@@]2([H])C(CC[C@]2(/C(C)=C/C3)[H])=C)\C)O)[C@]3([H])[C@H]1C(C)C |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-22776 | Hypotaurine (Standard) | Inquiry |
|
| MDP-11049 | Acarbose | Inquiry |
|
| MDP-12652 | Palmarumycin C3 | Inquiry |
|
| MDP-22565 | 10-Decarbamoyloxy-9-dehydromitomycin B | Inquiry |
|
| MDP-11379 | Dodecanoylcarnitine | Inquiry |
|
| MDP-23602 | Epoformin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
