Vellosimine | Synonyms | (+)-Vellosimine; Alkaloid RB 19 |
| CAS | 6874-98-2 |
| Molecular Weight | 292.37 |
| Formula | C19H20N2O |
| SMILES | O=C[C@H]1[C@@]2([H])[N@@]3[C@](C[C@@]1([H])/C(C3)=C\C)([H])C4=C(C2)C5=CC=CC=C5N4 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-14110 | Matairesinol | Inquiry |
|
| PDP-19602 | Rhaponticin 6"-O-gallate | Inquiry |
|
| PDP-14688 | Specneuzhenide | Inquiry |
|
| PDP-15929 | Cycloposine | Inquiry |
|
| PDP-18722 | 10-Hydroxy Majoroside | Inquiry |
|
| PDP-16367 | Macamide B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
