Verbenone | Synonyms | (-)-Verbenone |
| Appearance | Liquid (Density: 0.975 g/cm3) |
| CAS | 1196-01-6 |
| Purity | 99.27% |
| Molecular Weight | 150.22 |
| Formula | C10H14O |
| Color | Colorless to light yellow |
| SMILES | O=C1[C@](C2)([H])C(C)(C)[C@]2([H])C(C)=C1 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
Pure form -20°C 3 years; 4°C 2 years In solvent: -80°C 6 months; -20°C 1 month |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-20212 | Scopolamine (hydrobromide Trihydrate) (Standard) | Inquiry |
|
| PDP-13669 | (20S)-Protopanaxadiol | Inquiry |
|
| PDP-16903 | Saponin CP6 | Inquiry |
|
| PDP-18569 | Daphylloside | Inquiry |
|
| PDP-16605 | 3-Carene | Inquiry |
|
| PDP-15080 | Negletein | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
