Vernolide B | CAS | 618860-58-5 |
| Molecular Weight | 434.48 |
| Formula | C23H30O8 |
| SMILES | O=C(/C(C)=C/C)O[C@@H](C[C@H]1C)C(/C(OC2=O)=C\[C@](O[C@]13OC)(CC3)C)=C2COC(C)=O |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-17326 | Viroxocin | Inquiry |
|
| PDP-19292 | Hymenoxin | Inquiry |
|
| PDP-19801 | Linderane (Standard) | Inquiry |
|
| PDP-15166 | N-Vanillyldecanamide | Inquiry |
|
| PDP-16016 | Chlorogenin | Inquiry |
|
| PDP-13680 | Stachydrine Hydrochloride | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
