Viridicatol | CAS No. | 14484-44-7 |
| Purity | 98.44% |
| Molecular Weight | 253.25 |
| Formula | C15H11NO3 |
| Appearance | Solid |
| Color | White to off-white |
| SMILES | O=C1NC2=C(C=CC=C2)C(C3=CC=CC(O)=C3)=C1O |
| Intended Use | For research use only. |
| Shipping | Room temperature |
| Storage |
Powder: -20°C 3 years; 4°C 2 years In solvent: -80°C 6 months; -20°C 1 month |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-23117 | 1,2-Dihydroxynaphthalene | Inquiry |
|
| MDP-12755 | Monaspin B | Inquiry |
|
| MDP-12653 | Stephacidin B | Inquiry |
|
| MDP-23142 | Dolichol-20 | Inquiry |
|
| MDP-11101 | Camostat Mesylate | Inquiry |
|
| MDP-12718 | UDP-xylose | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
