Vitexilactone | CAS | 61263-49-8 |
| Molecular Weight | 378.50 |
| Formula | C22H34O5 |
| SMILES | O=C1OCC(CC[C@@]2(O)[C@H](C)C[C@@H](OC(C)=O)[C@@]3([H])C(C)(C)CCC[C@]23C)=C1 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-18129 | (2R)-Norpterosin B | Inquiry |
|
| PDP-16141 | Kobusin | Inquiry |
|
| PDP-20124 | Cyanidin 3,5-diglucoside (chloride) (Standard) | Inquiry |
|
| PDP-16894 | β-Furoyleupatolide | Inquiry |
|
| PDP-19813 | Phellodendrine Chloride (Standard) | Inquiry |
|
| PDP-14999 | RA-V | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
