WS9326A | CAS No. | 125774-71-2 |
| Molecular Weight | 1037.16 |
| Formula | C54H68N8O13 |
| SMILES | OC[C@H](NC([C@H](NC([C@H](N1)[C@@H](C)O)=O)CC(N)=O)=O)C(O[C@@H]([C@@H](C(N(/C(C(N[C@@H](C(N[C@H](CC2=CC=CC=C2)C1=O)=O)CC(C)C)=O)=C\C3=CC=C(O)C=C3)C)=O)NC(/C=C/C4=C(/C=C/CCC)C=CC=C4)=O)C)=O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-24075 | 4-Hydroxybaumycinol A1 | Inquiry |
|
| MDP-23932 | Ezomycin A2 | Inquiry |
|
| MDP-12713 | (±)-Hydnocarpin | Inquiry |
|
| MDP-22984 | Lienomycin | Inquiry |
|
| MDP-23369 | Se-Methylselenocysteine (Standard) | Inquiry |
|
| MDP-12692 | Alterbrassicene B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
